C16H20O5 — CID 151885937
(E)-2-(2-hydroxypropyl)-3-(2-phenylpropan-2-yl)but-2-enedioic acid (PubChem CID 151885937) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (E)-2-(2-hydroxypropyl)-3-(2-phenylpropan-2-yl)but-2-enedioic acid.
| Compound Name | (E)-2-(2-hydroxypropyl)-3-(2-phenylpropan-2-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 151885937 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (E)-2-(2-hydroxypropyl)-3-(2-phenylpropan-2-yl)but-2-enedioic acid |
| SMILES | CC(O)C/C(C(=O)O)=C(\C(=O)O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H20O5/c1-10(17)9-12(14(18)19)13(15(20)21)16(2,3)11-7-5-4-6-8-11/h4-8,10,17H,9H2,1-3H3,(H,18,19)(H,20,21)/b13-12- |
| InChIKey | SPRZGYXIDMXFCQ-SEYXRHQNSA-N |
| XLogP | 2.20 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|