C29H30N2O2 — CID 151886064
5-[(1E,6E)-7-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-dienyl]-1-methylindole (PubChem CID 151886064) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 5-[(1E,6E)-7-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-dienyl]-1-methylindole.
| Compound Name | 5-[(1E,6E)-7-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-dienyl]-1-methylindole |
|---|---|
| PubChem CID | 151886064 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-[(1E,6E)-7-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-dienyl]-1-methylindole |
| SMILES | COc1cc(OCc2ccccn2)ccc1/C=C/CCC/C=C/c1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C29H30N2O2/c1-31-19-17-25-20-23(13-16-28(25)31)10-6-4-3-5-7-11-24-14-15-27(21-29(24)32-2)33-22-26-12-8-9-18-30-26/h6-21H,3-5,22H2,1-2H3/b10-6+,11-7+ |
| InChIKey | SPSNZBXJCQUNOX-JMQWPVDRSA-N |
| XLogP | 7.06 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|