About (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol
(2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol (PubChem CID 15188648) has the molecular formula C13H22OP2
and a molecular weight of 256.27 g/mol. Its IUPAC name is (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol.
Molecular Properties
| Compound Name | (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol |
| PubChem CID | 15188648 |
| Molecular Formula | C13H22OP2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol |
| SMILES | CC(C)(C)c1cc(CO)pc(C(C)(C)C)p1 |
| InChI | InChI=1S/C13H22OP2/c1-12(2,3)10-7-9(8-14)15-11(16-10)13(4,5)6/h7,14H,8H2,1-6H3 |
| InChIKey | ILXFEEPUBIDCDP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol?
The IUPAC name of (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol (CID 15188648) is (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol.
What is the SMILES notation for (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol?
The canonical SMILES for (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol is CC(C)(C)c1cc(CO)pc(C(C)(C)C)p1.
What is the InChIKey of (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol?
The InChIKey is ILXFEEPUBIDCDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22OP2/c1-12(2,3)10-7-9(8-14)15-11(16-10)13(4,5)6/h7,14H,8H2,1-6H3.
What are the key properties of (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol?
(2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol has a molecular weight of 256.27 g/mol, XLogP of 4.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-ditert-butyl-1,3-diphosphinin-4-yl)methanol is sourced from PubChem (CID 15188648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).