C11H11N3O5S — CID 151887648
ethyl 5-(4-sulfamoylphenyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 151887648) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is ethyl 5-(4-sulfamoylphenyl)-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | ethyl 5-(4-sulfamoylphenyl)-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 151887648 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | ethyl 5-(4-sulfamoylphenyl)-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(-c2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C11H11N3O5S/c1-2-18-11(15)10-14-13-9(19-10)7-3-5-8(6-4-7)20(12,16)17/h3-6H,2H2,1H3,(H2,12,16,17) |
| InChIKey | SQBDECJLRQUAMO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |