C20H21NO5 — CID 15188842
dimethyl 3-methyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate (PubChem CID 15188842) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is dimethyl 3-methyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 15188842 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | dimethyl 3-methyl-2,5-diphenyl-1,3-oxazolidine-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(c2ccccc2)OC(c2ccccc2)N1C |
| InChI | InChI=1S/C20H21NO5/c1-21-17(15-12-8-5-9-13-15)26-16(14-10-6-4-7-11-14)20(21,18(22)24-2)19(23)25-3/h4-13,16-17H,1-3H3 |
| InChIKey | BIWHXTCPVDYCQE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|