About 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine
4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine (PubChem CID 151889069) has the molecular formula C17H19F2N3O2S
and a molecular weight of 367.42 g/mol. Its IUPAC name is 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine |
| PubChem CID | 151889069 |
| Molecular Formula | C17H19F2N3O2S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine |
| SMILES | Cc1cc(N2CCC(S(=O)(=O)c3ccc(F)cc3F)CC2)c(N)cn1 |
| InChI | InChI=1S/C17H19F2N3O2S/c1-11-8-16(15(20)10-21-11)22-6-4-13(5-7-22)25(23,24)17-3-2-12(18)9-14(17)19/h2-3,8-10,13H,4-7,20H2,1H3 |
| InChIKey | SQIRQTUXYZKSNZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine?
The IUPAC name of 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine (CID 151889069) is 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine.
What is the SMILES notation for 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine?
The canonical SMILES for 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine is Cc1cc(N2CCC(S(=O)(=O)c3ccc(F)cc3F)CC2)c(N)cn1.
What is the InChIKey of 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine?
The InChIKey is SQIRQTUXYZKSNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2N3O2S/c1-11-8-16(15(20)10-21-11)22-6-4-13(5-7-22)25(23,24)17-3-2-12(18)9-14(17)19/h2-3,8-10,13H,4-7,20H2,1H3.
What are the key properties of 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine?
4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine has a molecular weight of 367.42 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,4-difluorophenyl)sulfonylpiperidin-1-yl]-6-methylpyridin-3-amine is sourced from PubChem (CID 151889069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).