C18H16N2O6S — CID 151889618
4-oxo-7-(2,4,6-trimethylphenyl)sulfonyloxy-1H-1,8-naphthyridine-3-carboxylic acid (PubChem CID 151889618) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 4-oxo-7-(2,4,6-trimethylphenyl)sulfonyloxy-1H-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 4-oxo-7-(2,4,6-trimethylphenyl)sulfonyloxy-1H-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 151889618 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-oxo-7-(2,4,6-trimethylphenyl)sulfonyloxy-1H-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2ccc3c(=O)c(C(=O)O)c[nH]c3n2)c(C)c1 |
| InChI | InChI=1S/C18H16N2O6S/c1-9-6-10(2)16(11(3)7-9)27(24,25)26-14-5-4-12-15(21)13(18(22)23)8-19-17(12)20-14/h4-8H,1-3H3,(H,22,23)(H,19,20,21) |
| InChIKey | SQLOOFCTKGCLDA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|