About N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide
N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide (PubChem CID 151890382) has the molecular formula C13H17F2NO2
and a molecular weight of 257.28 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide |
| PubChem CID | 151890382 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(O)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H17F2NO2/c1-4-13(2,3)12(17)16(18)8-9-5-10(14)7-11(15)6-9/h5-7,18H,4,8H2,1-3H3 |
| InChIKey | SQPMQJPGOUAGHC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide?
The IUPAC name of N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide (CID 151890382) is N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide.
What is the SMILES notation for N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide?
The canonical SMILES for N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide is CCC(C)(C)C(=O)N(O)Cc1cc(F)cc(F)c1.
What is the InChIKey of N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide?
The InChIKey is SQPMQJPGOUAGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO2/c1-4-13(2,3)12(17)16(18)8-9-5-10(14)7-11(15)6-9/h5-7,18H,4,8H2,1-3H3.
What are the key properties of N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide?
N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide has a molecular weight of 257.28 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-difluorophenyl)methyl]-N-hydroxy-2,2-dimethylbutanamide is sourced from PubChem (CID 151890382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).