About S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate
S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate (PubChem CID 151892497) has the molecular formula C31H56O3SSi
and a molecular weight of 536.94 g/mol. Its IUPAC name is S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate.
Molecular Properties
| Compound Name | S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate |
| PubChem CID | 151892497 |
| Molecular Formula | C31H56O3SSi |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCCC[Si](CCCC)(OCCCC)Oc1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C31H56O3SSi/c1-8-11-14-15-16-18-31(32)35-22-17-24-36(23-13-10-3,33-21-12-9-2)34-30-20-19-28(26(4)5)25-29(30)27(6)7/h19-20,25-27H,8-18,21-24H2,1-7H3 |
| InChIKey | SRAIBFFVTNNZTQ-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate?
The IUPAC name of S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate (CID 151892497) is S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate.
What is the SMILES notation for S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate?
The canonical SMILES for S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate is CCCCCCCC(=O)SCCC[Si](CCCC)(OCCCC)Oc1ccc(C(C)C)cc1C(C)C.
What is the InChIKey of S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate?
The InChIKey is SRAIBFFVTNNZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H56O3SSi/c1-8-11-14-15-16-18-31(32)35-22-17-24-36(23-13-10-3,33-21-12-9-2)34-30-20-19-28(26(4)5)25-29(30)27(6)7/h19-20,25-27H,8-18,21-24H2,1-7H3.
What are the key properties of S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate?
S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate has a molecular weight of 536.94 g/mol, XLogP of 10.38, 21 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[3-[butoxy-butyl-[2,4-di(propan-2-yl)phenoxy]silyl]propyl] octanethioate is sourced from PubChem (CID 151892497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).