C18H14F9IO3S — CID 15189263
[(2-methylphenyl)-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-lambda3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 15189263) has the molecular formula C18H14F9IO3S and a molecular weight of 608.26 g/mol. Its IUPAC name is [(2-methylphenyl)-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-lambda3-iodanyl] 4-methylbenzenesulfonate.
| Compound Name | [(2-methylphenyl)-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-lambda3-iodanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15189263 |
| Molecular Formula | C18H14F9IO3S |
| Molecular Weight | 608.26 g/mol |
| Exact Mass | 607.96 |
| IUPAC Name | [(2-methylphenyl)-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-lambda3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OI(c2ccccc2C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F9IO3S/c1-11-7-9-13(10-8-11)32(29,30)31-28(14-6-4-3-5-12(14)2)18(26,27)16(21,22)15(19,20)17(23,24)25/h3-10H,1-2H3 |
| InChIKey | QUIWEEVMILBOHB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.26 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|