C13H16N2O5 — CID 151895810
ethyl 5-(4,6-dimethoxypyrimidin-5-yl)-3-oxopent-4-enoate (PubChem CID 151895810) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is ethyl 5-(4,6-dimethoxypyrimidin-5-yl)-3-oxopent-4-enoate.
| Compound Name | ethyl 5-(4,6-dimethoxypyrimidin-5-yl)-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 151895810 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | ethyl 5-(4,6-dimethoxypyrimidin-5-yl)-3-oxopent-4-enoate |
| SMILES | CCOC(=O)CC(=O)C=Cc1c(OC)ncnc1OC |
| InChI | InChI=1S/C13H16N2O5/c1-4-20-11(17)7-9(16)5-6-10-12(18-2)14-8-15-13(10)19-3/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | SRRPKQLNMSINPM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|