C26H34N4O2 — CID 151897870
2-[2-[3-[(3,3,5-trimethyl-2,4-dihydro-1H-1,5-benzodiazepin-7-yl)oxy]propylamino]ethyl]isoquinolin-1-one (PubChem CID 151897870) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[2-[3-[(3,3,5-trimethyl-2,4-dihydro-1H-1,5-benzodiazepin-7-yl)oxy]propylamino]ethyl]isoquinolin-1-one.
| Compound Name | 2-[2-[3-[(3,3,5-trimethyl-2,4-dihydro-1H-1,5-benzodiazepin-7-yl)oxy]propylamino]ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 151897870 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-[2-[3-[(3,3,5-trimethyl-2,4-dihydro-1H-1,5-benzodiazepin-7-yl)oxy]propylamino]ethyl]isoquinolin-1-one |
| SMILES | CN1CC(C)(C)CNc2ccc(OCCCNCCn3ccc4ccccc4c3=O)cc21 |
| InChI | InChI=1S/C26H34N4O2/c1-26(2)18-28-23-10-9-21(17-24(23)29(3)19-26)32-16-6-12-27-13-15-30-14-11-20-7-4-5-8-22(20)25(30)31/h4-5,7-11,14,17,27-28H,6,12-13,15-16,18-19H2,1-3H3 |
| InChIKey | SSDCNZXZAJGVFC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|