C19H23NO2 — CID 15189988
tert-butyl (2S)-2-naphthalen-2-ylpyrrolidine-1-carboxylate (PubChem CID 15189988) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-naphthalen-2-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-naphthalen-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15189988 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | tert-butyl (2S)-2-naphthalen-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H23NO2/c1-19(2,3)22-18(21)20-12-6-9-17(20)16-11-10-14-7-4-5-8-15(14)13-16/h4-5,7-8,10-11,13,17H,6,9,12H2,1-3H3/t17-/m0/s1 |
| InChIKey | MOABNQPHUDXVDB-KRWDZBQOSA-N |
| XLogP | 4.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |