About tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate
tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate (PubChem CID 151901384) has the molecular formula C23H36N2O5
and a molecular weight of 420.55 g/mol. Its IUPAC name is tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate |
| PubChem CID | 151901384 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)CC(=O)C1CCC(c2cnn(CC(C)(C)C(=O)OC(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C23H36N2O5/c1-7-29-20(27)12-19(26)17-10-8-16(9-11-17)18-13-24-25(14-18)15-23(5,6)21(28)30-22(2,3)4/h13-14,16-17H,7-12,15H2,1-6H3 |
| InChIKey | SSVMDWBFPFCMLB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate?
The IUPAC name of tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate (CID 151901384) is tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate.
What is the SMILES notation for tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate?
The canonical SMILES for tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate is CCOC(=O)CC(=O)C1CCC(c2cnn(CC(C)(C)C(=O)OC(C)(C)C)c2)CC1.
What is the InChIKey of tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate?
The InChIKey is SSVMDWBFPFCMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36N2O5/c1-7-29-20(27)12-19(26)17-10-8-16(9-11-17)18-13-24-25(14-18)15-23(5,6)21(28)30-22(2,3)4/h13-14,16-17H,7-12,15H2,1-6H3.
What are the key properties of tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate?
tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate has a molecular weight of 420.55 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[4-[4-(3-ethoxy-3-oxopropanoyl)cyclohexyl]pyrazol-1-yl]-2,2-dimethylpropanoate is sourced from PubChem (CID 151901384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).