About 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole
2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole (PubChem CID 15190237) has the molecular formula C8H6S5
and a molecular weight of 262.47 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole.
Molecular Properties
| Compound Name | 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole |
| PubChem CID | 15190237 |
| Molecular Formula | C8H6S5 |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 261.91 |
| IUPAC Name | 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole |
| SMILES | c1scc2c1SC(=C1SCCS1)S2 |
| InChI | InChI=1S/C8H6S5/c1-2-11-7(10-1)8-12-5-3-9-4-6(5)13-8/h3-4H,1-2H2 |
| InChIKey | HINYYCLAYCVZTI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole?
The IUPAC name of 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole (CID 15190237) is 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole.
What is the SMILES notation for 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole?
The canonical SMILES for 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole is c1scc2c1SC(=C1SCCS1)S2.
What is the InChIKey of 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole?
The InChIKey is HINYYCLAYCVZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S5/c1-2-11-7(10-1)8-12-5-3-9-4-6(5)13-8/h3-4H,1-2H2.
What are the key properties of 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole?
2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole has a molecular weight of 262.47 g/mol, XLogP of 4.55, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithiolan-2-ylidene)thieno[3,4-d][1,3]dithiole is sourced from PubChem (CID 15190237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).