About pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate
pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate (PubChem CID 151907426) has the molecular formula C25H25N3O3
and a molecular weight of 415.49 g/mol. Its IUPAC name is pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate |
| PubChem CID | 151907426 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(NC(=O)Oc1cccnc1)c1ccc(-c2ccc(OCCCC#N)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-25(2,28-24(29)31-23-6-5-16-27-18-23)21-11-7-19(8-12-21)20-9-13-22(14-10-20)30-17-4-3-15-26/h5-14,16,18H,3-4,17H2,1-2H3,(H,28,29) |
| InChIKey | SUAQAFUXOISHCI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate?
The IUPAC name of pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate (CID 151907426) is pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate.
What is the SMILES notation for pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate?
The canonical SMILES for pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate is CC(C)(NC(=O)Oc1cccnc1)c1ccc(-c2ccc(OCCCC#N)cc2)cc1.
What is the InChIKey of pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate?
The InChIKey is SUAQAFUXOISHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O3/c1-25(2,28-24(29)31-23-6-5-16-27-18-23)21-11-7-19(8-12-21)20-9-13-22(14-10-20)30-17-4-3-15-26/h5-14,16,18H,3-4,17H2,1-2H3,(H,28,29).
What are the key properties of pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate?
pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate has a molecular weight of 415.49 g/mol, XLogP of 5.45, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl N-[2-[4-[4-(3-cyanopropoxy)phenyl]phenyl]propan-2-yl]carbamate is sourced from PubChem (CID 151907426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).