About sulfuryl diazide
sulfuryl diazide (PubChem CID 15191028) has the molecular formula N6O2S
and a molecular weight of 148.11 g/mol. Its IUPAC name is sulfuryl diazide.
Molecular Properties
| Compound Name | sulfuryl diazide |
|---|
| PubChem CID | 15191028 |
|---|
| Molecular Formula | N6O2S |
|---|
| Molecular Weight | 148.11 g/mol |
|---|
| Exact Mass | 147.98 |
|---|
| IUPAC Name | sulfuryl diazide |
|---|
| SMILES | [N-]=[N+]=NS(=O)(=O)N=[N+]=[N-] |
|---|
| InChI | InChI=1S/N6O2S/c1-3-5-9(7,8)6-4-2 |
|---|
| InChIKey | HSVFKFNNMLUVEY-UHFFFAOYSA-N |
|---|
| XLogP | 0.85 |
|---|
| TPSA | 131.66 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze sulfuryl diazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuryl diazide?
The IUPAC name of sulfuryl diazide (CID 15191028) is sulfuryl diazide.
What is the SMILES notation for sulfuryl diazide?
The canonical SMILES for sulfuryl diazide is [N-]=[N+]=NS(=O)(=O)N=[N+]=[N-].
What is the InChIKey of sulfuryl diazide?
The InChIKey is HSVFKFNNMLUVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/N6O2S/c1-3-5-9(7,8)6-4-2.
What are the key properties of sulfuryl diazide?
sulfuryl diazide has a molecular weight of 148.11 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuryl diazide is sourced from PubChem (CID 15191028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).