About 2,2-dibutylindole
2,2-dibutylindole (PubChem CID 151910527) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is 2,2-dibutylindole.
Molecular Properties
| Compound Name | 2,2-dibutylindole |
| PubChem CID | 151910527 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2,2-dibutylindole |
| SMILES | CCCCC1(CCCC)C=c2ccccc2=N1 |
| InChI | InChI=1S/C16H23N/c1-3-5-11-16(12-6-4-2)13-14-9-7-8-10-15(14)17-16/h7-10,13H,3-6,11-12H2,1-2H3 |
| InChIKey | SURBMGBPGJYLBG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dibutylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibutylindole?
The IUPAC name of 2,2-dibutylindole (CID 151910527) is 2,2-dibutylindole.
What is the SMILES notation for 2,2-dibutylindole?
The canonical SMILES for 2,2-dibutylindole is CCCCC1(CCCC)C=c2ccccc2=N1.
What is the InChIKey of 2,2-dibutylindole?
The InChIKey is SURBMGBPGJYLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N/c1-3-5-11-16(12-6-4-2)13-14-9-7-8-10-15(14)17-16/h7-10,13H,3-6,11-12H2,1-2H3.
What are the key properties of 2,2-dibutylindole?
2,2-dibutylindole has a molecular weight of 229.37 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibutylindole is sourced from PubChem (CID 151910527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).