C8H8F6 — CID 15191144
1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hexa-2,4-diene (PubChem CID 15191144) has the molecular formula C8H8F6 and a molecular weight of 218.14 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hexa-2,4-diene.
| Compound Name | 1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 15191144 |
| Molecular Formula | C8H8F6 |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1,1,1-trifluoro-5-methyl-2-(trifluoromethyl)hexa-2,4-diene |
| SMILES | CC(C)=CC=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6/c1-5(2)3-4-6(7(9,10)11)8(12,13)14/h3-4H,1-2H3 |
| InChIKey | IBHWVJDTSPHTJG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|