C22H13N3O3S3 — CID 15191211
(5E)-3-phenyl-5-[3-phenyl-5-(thiophene-2-carbonyl)-1,3,4-thiadiazol-2-ylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 15191211) has the molecular formula C22H13N3O3S3 and a molecular weight of 463.57 g/mol. Its IUPAC name is (5E)-3-phenyl-5-[3-phenyl-5-(thiophene-2-carbonyl)-1,3,4-thiadiazol-2-ylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-phenyl-5-[3-phenyl-5-(thiophene-2-carbonyl)-1,3,4-thiadiazol-2-ylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 15191211 |
| Molecular Formula | C22H13N3O3S3 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | (5E)-3-phenyl-5-[3-phenyl-5-(thiophene-2-carbonyl)-1,3,4-thiadiazol-2-ylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(C1=NN(c2ccccc2)/C(=C2\SC(=O)N(c3ccccc3)C2=O)S1)c1cccs1 |
| InChI | InChI=1S/C22H13N3O3S3/c26-17(16-12-7-13-29-16)19-23-25(15-10-5-2-6-11-15)21(31-19)18-20(27)24(22(28)30-18)14-8-3-1-4-9-14/h1-13H/b21-18+ |
| InChIKey | WATNJASNPPFALW-DYTRJAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|