About 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione
4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione (PubChem CID 151916777) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione |
| PubChem CID | 151916777 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione |
| SMILES | CCOCc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C6H10N2OS/c1-2-9-4-5-3-7-6(10)8-5/h3H,2,4H2,1H3,(H2,7,8,10) |
| InChIKey | SVXQBURXRIUSRP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione (CID 151916777) is 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione is CCOCc1c[nH]c(=S)[nH]1.
What is the InChIKey of 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione?
The InChIKey is SVXQBURXRIUSRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c1-2-9-4-5-3-7-6(10)8-5/h3H,2,4H2,1H3,(H2,7,8,10).
What are the key properties of 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione?
4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione has a molecular weight of 158.23 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethoxymethyl)-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 151916777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).