About cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+)
cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) (PubChem CID 15191942) has the molecular formula C11H9Cl2Fe+
and a molecular weight of 267.94 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+).
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) |
| PubChem CID | 15191942 |
| Molecular Formula | C11H9Cl2Fe+ |
| Molecular Weight | 267.94 g/mol |
| Exact Mass | 266.94 |
| IUPAC Name | cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) |
| SMILES | Clc1ccc(Cl)cc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C6H4Cl2.C5H5.Fe/c7-5-1-2-6(8)4-3-5;1-2-4-5-3-1;/h1-4H;1-5H;/q;-1;+2 |
| InChIKey | LHFFEDFUTOFAGZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+)?
The IUPAC name of cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) (CID 15191942) is cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+).
What is the SMILES notation for cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+)?
The canonical SMILES for cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) is Clc1ccc(Cl)cc1.[Fe+2].c1cc[cH-]c1.
What is the InChIKey of cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+)?
The InChIKey is LHFFEDFUTOFAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C5H5.Fe/c7-5-1-2-6(8)4-3-5;1-2-4-5-3-1;/h1-4H;1-5H;/q;-1;+2.
What are the key properties of cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+)?
cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) has a molecular weight of 267.94 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;1,4-dichlorobenzene;iron(2+) is sourced from PubChem (CID 15191942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).