C11H13F3N2O2S — CID 151920218
(E)-N-propan-2-yloxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine (PubChem CID 151920218) has the molecular formula C11H13F3N2O2S and a molecular weight of 294.30 g/mol. Its IUPAC name is (E)-N-propan-2-yloxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine.
| Compound Name | (E)-N-propan-2-yloxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 151920218 |
| Molecular Formula | C11H13F3N2O2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (E)-N-propan-2-yloxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine |
| SMILES | CC(C)O/N=C/c1cnc(SCCC(F)=C(F)F)o1 |
| InChI | InChI=1S/C11H13F3N2O2S/c1-7(2)18-16-6-8-5-15-11(17-8)19-4-3-9(12)10(13)14/h5-7H,3-4H2,1-2H3/b16-6+ |
| InChIKey | SWPLKAZVNOWYNC-OMCISZLKSA-N |
| XLogP | 3.99 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|