C19H12F13IO3S — CID 15192147
[phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 15192147) has the molecular formula C19H12F13IO3S and a molecular weight of 694.25 g/mol. Its IUPAC name is [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] 4-methylbenzenesulfonate.
| Compound Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15192147 |
| Molecular Formula | C19H12F13IO3S |
| Molecular Weight | 694.25 g/mol |
| Exact Mass | 693.93 |
| IUPAC Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OI(c2ccccc2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12F13IO3S/c1-11-7-9-13(10-8-11)37(34,35)36-33(12-5-3-2-4-6-12)19(31,32)17(26,27)15(22,23)14(20,21)16(24,25)18(28,29)30/h2-10H,1H3 |
| InChIKey | XTVDTPLVHOXYOI-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.25 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|