About 1-chloro-9,9-dimethyl-10H-acridine
1-chloro-9,9-dimethyl-10H-acridine (PubChem CID 151923654) has the molecular formula C15H14ClN
and a molecular weight of 243.74 g/mol. Its IUPAC name is 1-chloro-9,9-dimethyl-10H-acridine.
Molecular Properties
| Compound Name | 1-chloro-9,9-dimethyl-10H-acridine |
| PubChem CID | 151923654 |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 1-chloro-9,9-dimethyl-10H-acridine |
| SMILES | CC1(C)c2ccccc2Nc2cccc(Cl)c21 |
| InChI | InChI=1S/C15H14ClN/c1-15(2)10-6-3-4-8-12(10)17-13-9-5-7-11(16)14(13)15/h3-9,17H,1-2H3 |
| InChIKey | SXHIIUSGQIRQQX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-9,9-dimethyl-10H-acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-9,9-dimethyl-10H-acridine?
The IUPAC name of 1-chloro-9,9-dimethyl-10H-acridine (CID 151923654) is 1-chloro-9,9-dimethyl-10H-acridine.
What is the SMILES notation for 1-chloro-9,9-dimethyl-10H-acridine?
The canonical SMILES for 1-chloro-9,9-dimethyl-10H-acridine is CC1(C)c2ccccc2Nc2cccc(Cl)c21.
What is the InChIKey of 1-chloro-9,9-dimethyl-10H-acridine?
The InChIKey is SXHIIUSGQIRQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN/c1-15(2)10-6-3-4-8-12(10)17-13-9-5-7-11(16)14(13)15/h3-9,17H,1-2H3.
What are the key properties of 1-chloro-9,9-dimethyl-10H-acridine?
1-chloro-9,9-dimethyl-10H-acridine has a molecular weight of 243.74 g/mol, XLogP of 4.72, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-9,9-dimethyl-10H-acridine is sourced from PubChem (CID 151923654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).