About dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate
dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate (PubChem CID 15192730) has the molecular formula C20H27NO6
and a molecular weight of 377.44 g/mol. Its IUPAC name is dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate |
| PubChem CID | 15192730 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)OC)C[C@H]1c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C20H27NO6/c1-24-17-9-8-13(10-18(17)27-14-6-4-5-7-14)15-11-21(20(23)26-3)12-16(15)19(22)25-2/h8-10,14-16H,4-7,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | CKHXIYDCQPVVOE-JKSUJKDBSA-N |
| XLogP | 2.97 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
The IUPAC name of dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate (CID 15192730) is dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate.
What is the SMILES notation for dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
The canonical SMILES for dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate is COC(=O)[C@@H]1CN(C(=O)OC)C[C@H]1c1ccc(OC)c(OC2CCCC2)c1.
What is the InChIKey of dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
The InChIKey is CKHXIYDCQPVVOE-JKSUJKDBSA-N. The full InChI is InChI=1S/C20H27NO6/c1-24-17-9-8-13(10-18(17)27-14-6-4-5-7-14)15-11-21(20(23)26-3)12-16(15)19(22)25-2/h8-10,14-16H,4-7,11-12H2,1-3H3/t15-,16+/m0/s1.
What are the key properties of dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate?
dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate has a molecular weight of 377.44 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (3S,4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1,3-dicarboxylate is sourced from PubChem (CID 15192730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).