About 3-propan-2-yl-6,7-dihydro-1H-indazole
3-propan-2-yl-6,7-dihydro-1H-indazole (PubChem CID 15192807) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-propan-2-yl-6,7-dihydro-1H-indazole.
Molecular Properties
| Compound Name | 3-propan-2-yl-6,7-dihydro-1H-indazole |
| PubChem CID | 15192807 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-propan-2-yl-6,7-dihydro-1H-indazole |
| SMILES | CC(C)c1n[nH]c2c1C=CCC2 |
| InChI | InChI=1S/C10H14N2/c1-7(2)10-8-5-3-4-6-9(8)11-12-10/h3,5,7H,4,6H2,1-2H3,(H,11,12) |
| InChIKey | YJGUSCUTYIDORO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propan-2-yl-6,7-dihydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-6,7-dihydro-1H-indazole?
The IUPAC name of 3-propan-2-yl-6,7-dihydro-1H-indazole (CID 15192807) is 3-propan-2-yl-6,7-dihydro-1H-indazole.
What is the SMILES notation for 3-propan-2-yl-6,7-dihydro-1H-indazole?
The canonical SMILES for 3-propan-2-yl-6,7-dihydro-1H-indazole is CC(C)c1n[nH]c2c1C=CCC2.
What is the InChIKey of 3-propan-2-yl-6,7-dihydro-1H-indazole?
The InChIKey is YJGUSCUTYIDORO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-7(2)10-8-5-3-4-6-9(8)11-12-10/h3,5,7H,4,6H2,1-2H3,(H,11,12).
What are the key properties of 3-propan-2-yl-6,7-dihydro-1H-indazole?
3-propan-2-yl-6,7-dihydro-1H-indazole has a molecular weight of 162.24 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-6,7-dihydro-1H-indazole is sourced from PubChem (CID 15192807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).