About dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane
dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 15192817) has the molecular formula C18H32Si3
and a molecular weight of 332.71 g/mol. Its IUPAC name is dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane.
Molecular Properties
| Compound Name | dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane |
| PubChem CID | 15192817 |
| Molecular Formula | C18H32Si3 |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | C[Si](C)(C)C1=CC([Si](C)(C)C2C=CC([Si](C)(C)C)=C2)C=C1 |
| InChI | InChI=1S/C18H32Si3/c1-19(2,3)15-9-11-17(13-15)21(7,8)18-12-10-16(14-18)20(4,5)6/h9-14,17-18H,1-8H3 |
| InChIKey | GKCVODCFZCRLLF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane?
The IUPAC name of dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane (CID 15192817) is dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane.
What is the SMILES notation for dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane?
The canonical SMILES for dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane is C[Si](C)(C)C1=CC([Si](C)(C)C2C=CC([Si](C)(C)C)=C2)C=C1.
What is the InChIKey of dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane?
The InChIKey is GKCVODCFZCRLLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32Si3/c1-19(2,3)15-9-11-17(13-15)21(7,8)18-12-10-16(14-18)20(4,5)6/h9-14,17-18H,1-8H3.
What are the key properties of dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane?
dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane has a molecular weight of 332.71 g/mol, XLogP of 6.18, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(3-trimethylsilylcyclopenta-2,4-dien-1-yl)silane is sourced from PubChem (CID 15192817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).