About thieno[2,3-h]isoquinoline
thieno[2,3-h]isoquinoline (PubChem CID 15192975) has the molecular formula C11H7NS
and a molecular weight of 185.25 g/mol. Its IUPAC name is thieno[2,3-h]isoquinoline.
Molecular Properties
| Compound Name | thieno[2,3-h]isoquinoline |
| PubChem CID | 15192975 |
| Molecular Formula | C11H7NS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | thieno[2,3-h]isoquinoline |
| SMILES | c1cc2ccc3sccc3c2cn1 |
| InChI | InChI=1S/C11H7NS/c1-2-11-9(4-6-13-11)10-7-12-5-3-8(1)10/h1-7H |
| InChIKey | VTHUHAKIWQTSNK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thieno[2,3-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-h]isoquinoline?
The IUPAC name of thieno[2,3-h]isoquinoline (CID 15192975) is thieno[2,3-h]isoquinoline.
What is the SMILES notation for thieno[2,3-h]isoquinoline?
The canonical SMILES for thieno[2,3-h]isoquinoline is c1cc2ccc3sccc3c2cn1.
What is the InChIKey of thieno[2,3-h]isoquinoline?
The InChIKey is VTHUHAKIWQTSNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NS/c1-2-11-9(4-6-13-11)10-7-12-5-3-8(1)10/h1-7H.
What are the key properties of thieno[2,3-h]isoquinoline?
thieno[2,3-h]isoquinoline has a molecular weight of 185.25 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-h]isoquinoline is sourced from PubChem (CID 15192975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).