About ditert-butyl 2-ethylpropanedioate
ditert-butyl 2-ethylpropanedioate (PubChem CID 15193073) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is ditert-butyl 2-ethylpropanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2-ethylpropanedioate |
| PubChem CID | 15193073 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | ditert-butyl 2-ethylpropanedioate |
| SMILES | CCC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-8-9(10(14)16-12(2,3)4)11(15)17-13(5,6)7/h9H,8H2,1-7H3 |
| InChIKey | WFALCSMFRJIZOX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-ethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-ethylpropanedioate?
The IUPAC name of ditert-butyl 2-ethylpropanedioate (CID 15193073) is ditert-butyl 2-ethylpropanedioate.
What is the SMILES notation for ditert-butyl 2-ethylpropanedioate?
The canonical SMILES for ditert-butyl 2-ethylpropanedioate is CCC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 2-ethylpropanedioate?
The InChIKey is WFALCSMFRJIZOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-8-9(10(14)16-12(2,3)4)11(15)17-13(5,6)7/h9H,8H2,1-7H3.
What are the key properties of ditert-butyl 2-ethylpropanedioate?
ditert-butyl 2-ethylpropanedioate has a molecular weight of 244.33 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-ethylpropanedioate is sourced from PubChem (CID 15193073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).