C17H28Cl2N2Si — CID 15193164
2,2-dichloro-1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,2-benzodiazasilole (PubChem CID 15193164) has the molecular formula C17H28Cl2N2Si and a molecular weight of 359.42 g/mol. Its IUPAC name is 2,2-dichloro-1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,2-benzodiazasilole.
| Compound Name | 2,2-dichloro-1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,2-benzodiazasilole |
|---|---|
| PubChem CID | 15193164 |
| Molecular Formula | C17H28Cl2N2Si |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2,2-dichloro-1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,2-benzodiazasilole |
| SMILES | Cc1ccc2c(c1)N(CC(C)(C)C)[Si](Cl)(Cl)N2CC(C)(C)C |
| InChI | InChI=1S/C17H28Cl2N2Si/c1-13-8-9-14-15(10-13)21(12-17(5,6)7)22(18,19)20(14)11-16(2,3)4/h8-10H,11-12H2,1-7H3 |
| InChIKey | XDZOBEFGMDTLLG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|