About 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one
7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 15193220) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
Analyze 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one?
The IUPAC name of 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (CID 15193220) is 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
What is the SMILES notation for 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one?
The canonical SMILES for 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one is O=C1OCC2CCCC(O)C12.
What is the InChIKey of 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one?
The InChIKey is BOVOETNCUSCZGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c9-6-3-1-2-5-4-11-8(10)7(5)6/h5-7,9H,1-4H2.
What are the key properties of 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one?
7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one has a molecular weight of 156.18 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one is sourced from PubChem (CID 15193220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).