About bis(2-ethyl-1,3-thiazol-4-yl)methanone
bis(2-ethyl-1,3-thiazol-4-yl)methanone (PubChem CID 151933109) has the molecular formula C11H12N2OS2
and a molecular weight of 252.36 g/mol. Its IUPAC name is bis(2-ethyl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | bis(2-ethyl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 151933109 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | bis(2-ethyl-1,3-thiazol-4-yl)methanone |
| SMILES | CCc1nc(C(=O)c2csc(CC)n2)cs1 |
| InChI | InChI=1S/C11H12N2OS2/c1-3-9-12-7(5-15-9)11(14)8-6-16-10(4-2)13-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | SZFKLYAMZYUUSK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2-ethyl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethyl-1,3-thiazol-4-yl)methanone?
The IUPAC name of bis(2-ethyl-1,3-thiazol-4-yl)methanone (CID 151933109) is bis(2-ethyl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for bis(2-ethyl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for bis(2-ethyl-1,3-thiazol-4-yl)methanone is CCc1nc(C(=O)c2csc(CC)n2)cs1.
What is the InChIKey of bis(2-ethyl-1,3-thiazol-4-yl)methanone?
The InChIKey is SZFKLYAMZYUUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS2/c1-3-9-12-7(5-15-9)11(14)8-6-16-10(4-2)13-8/h5-6H,3-4H2,1-2H3.
What are the key properties of bis(2-ethyl-1,3-thiazol-4-yl)methanone?
bis(2-ethyl-1,3-thiazol-4-yl)methanone has a molecular weight of 252.36 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethyl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 151933109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).