C16H30O3 — CID 151934074
2,3,3,5,5,6-hexamethyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane (PubChem CID 151934074) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 2,3,3,5,5,6-hexamethyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane.
| Compound Name | 2,3,3,5,5,6-hexamethyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane |
|---|---|
| PubChem CID | 151934074 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2,3,3,5,5,6-hexamethyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane |
| SMILES | CC=COCCCC1(C)OC(C)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H30O3/c1-8-11-17-12-9-10-16(7)15(5,6)19-14(3,4)13(2)18-16/h8,11,13H,9-10,12H2,1-7H3 |
| InChIKey | SZKKTBDRIREULJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|