C13H17NO3S — CID 15193420
(3R,4R)-3,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 15193420) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is (3R,4R)-3,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
| Compound Name | (3R,4R)-3,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15193420 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (3R,4R)-3,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](C)[C@@H](C)C2=O)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-9-4-6-12(7-5-9)18(16,17)14-8-10(2)11(3)13(14)15/h4-7,10-11H,8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | AREXEIGCJFLKBI-WDEREUQCSA-N |
| XLogP | 1.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |