C16H20NO3P — CID 151936038
[(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid (PubChem CID 151936038) has the molecular formula C16H20NO3P and a molecular weight of 305.31 g/mol. Its IUPAC name is [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid.
| Compound Name | [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid |
|---|---|
| PubChem CID | 151936038 |
| Molecular Formula | C16H20NO3P |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid |
| SMILES | C=CN(c1c(CC)c(CC)cc2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C16H20NO3P/c1-4-12-11-13-9-7-8-10-15(13)16(14(12)5-2)17(6-3)21(18,19)20/h6-11H,3-5H2,1-2H3,(H2,18,19,20) |
| InChIKey | SZUQLUSANANMGL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|