[(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid

C16H20NO3P — CID 151936038

IUPAC[(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid
SMILESC=CN(c1c(CC)c(CC)cc2ccccc12)P(=O)(O)O
InChIInChI=1S/C16H20NO3P/c1-4-12-11-13-9-7-8-10-15(13)16(14(12)5-2)17(6-3)21(18,19)20/h6-11H,3-5H2,1-2H3,(H2,18,19,20)
InChIKeySZUQLUSANANMGL-UHFFFAOYSA-N
MW305.31 g/mol
LogP4.01
Rot. Bonds5

About [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid

[(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid (PubChem CID 151936038) has the molecular formula C16H20NO3P and a molecular weight of 305.31 g/mol. Its IUPAC name is [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid.

Molecular Properties

Compound Name[(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid
PubChem CID151936038
Molecular FormulaC16H20NO3P
Molecular Weight305.31 g/mol
Exact Mass305.12
IUPAC Name[(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid
SMILESC=CN(c1c(CC)c(CC)cc2ccccc12)P(=O)(O)O
InChIInChI=1S/C16H20NO3P/c1-4-12-11-13-9-7-8-10-15(13)16(14(12)5-2)17(6-3)21(18,19)20/h6-11H,3-5H2,1-2H3,(H2,18,19,20)
InChIKeySZUQLUSANANMGL-UHFFFAOYSA-N
XLogP4.01
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.31
LogP ≤ 54.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid?
The IUPAC name of [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid (CID 151936038) is [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid.
What is the SMILES notation for [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid?
The canonical SMILES for [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid is C=CN(c1c(CC)c(CC)cc2ccccc12)P(=O)(O)O.
What is the InChIKey of [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid?
The InChIKey is SZUQLUSANANMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20NO3P/c1-4-12-11-13-9-7-8-10-15(13)16(14(12)5-2)17(6-3)21(18,19)20/h6-11H,3-5H2,1-2H3,(H2,18,19,20).
What are the key properties of [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid?
[(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid has a molecular weight of 305.31 g/mol, XLogP of 4.01, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,3-diethylnaphthalen-1-yl)-ethenylamino]phosphonic acid is sourced from PubChem (CID 151936038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).