About 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one
4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one (PubChem CID 151938123) has the molecular formula C11H7NO
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one.
Analyze 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one?
The IUPAC name of 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one (CID 151938123) is 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one.
What is the SMILES notation for 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one?
The canonical SMILES for 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one is O=C1C=CC23C=CN=C2C=CC1=C3.
What is the InChIKey of 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one?
The InChIKey is TUBPEXMIHZTBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO/c13-9-3-4-11-5-6-12-10(11)2-1-8(9)7-11/h1-7H.
What are the key properties of 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one?
4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one has a molecular weight of 169.18 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[6.3.1.01,5]dodeca-2,4,6,8(12),10-pentaen-9-one is sourced from PubChem (CID 151938123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).