C15H24N2O3 — CID 151939867
(2S,4S)-2-ethyl-4-methyl-6-(4-nitrophenoxy)hexan-1-amine (PubChem CID 151939867) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2S,4S)-2-ethyl-4-methyl-6-(4-nitrophenoxy)hexan-1-amine.
| Compound Name | (2S,4S)-2-ethyl-4-methyl-6-(4-nitrophenoxy)hexan-1-amine |
|---|---|
| PubChem CID | 151939867 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2S,4S)-2-ethyl-4-methyl-6-(4-nitrophenoxy)hexan-1-amine |
| SMILES | CCC(CN)C[C@H](C)CCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-13(11-16)10-12(2)8-9-20-15-6-4-14(5-7-15)17(18)19/h4-7,12-13H,3,8-11,16H2,1-2H3/t12-,13?/m1/s1 |
| InChIKey | TUKUHGCARUPSOL-PZORYLMUSA-N |
| XLogP | 3.37 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|