About 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol
5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol (PubChem CID 151940176) has the molecular formula C28H32O3
and a molecular weight of 416.56 g/mol. Its IUPAC name is 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol.
Molecular Properties
| Compound Name | 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol |
| PubChem CID | 151940176 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol |
| SMILES | CC(C)C1CCC(O)(C(c2ccccc2)(c2ccccc2)c2ccccc2)C(O)(O)C1 |
| InChI | InChI=1S/C28H32O3/c1-21(2)22-18-19-26(29,27(30,31)20-22)28(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,21-22,29-31H,18-20H2,1-2H3 |
| InChIKey | TUMJYQZANJMKGU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol?
The IUPAC name of 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol (CID 151940176) is 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol.
What is the SMILES notation for 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol?
The canonical SMILES for 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol is CC(C)C1CCC(O)(C(c2ccccc2)(c2ccccc2)c2ccccc2)C(O)(O)C1.
What is the InChIKey of 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol?
The InChIKey is TUMJYQZANJMKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32O3/c1-21(2)22-18-19-26(29,27(30,31)20-22)28(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,21-22,29-31H,18-20H2,1-2H3.
What are the key properties of 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol?
5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol has a molecular weight of 416.56 g/mol, XLogP of 4.89, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-2-tritylcyclohexane-1,1,2-triol is sourced from PubChem (CID 151940176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).