C22H22N4+2 — CID 15194038
6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene (PubChem CID 15194038) has the molecular formula C22H22N4+2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene.
| Compound Name | 6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene |
|---|---|
| PubChem CID | 15194038 |
| Molecular Formula | C22H22N4+2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 6,14-diaza-3,17-diazoniapentacyclo[17.3.1.13,6.18,12.114,17]hexacosa-1(23),3(26),4,8(25),9,11,15,17(24),19,21-decaene |
| SMILES | c1cc2cc(c1)Cn1cc[n+](c1)Cc1cccc(c1)C[n+]1ccn(c1)C2 |
| InChI | InChI=1S/C22H22N4/c1-3-19-11-20(4-1)14-24-8-10-26(18-24)16-22-6-2-5-21(12-22)15-25-9-7-23(13-19)17-25/h1-12,17-18H,13-16H2/q+2 |
| InChIKey | RQMWLCRTXYLURI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|