About 3-(1,1-diethoxyethyl)-2-methylundec-1-ene
3-(1,1-diethoxyethyl)-2-methylundec-1-ene (PubChem CID 151940396) has the molecular formula C18H36O2
and a molecular weight of 284.48 g/mol. Its IUPAC name is 3-(1,1-diethoxyethyl)-2-methylundec-1-ene.
Molecular Properties
| Compound Name | 3-(1,1-diethoxyethyl)-2-methylundec-1-ene |
| PubChem CID | 151940396 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 3-(1,1-diethoxyethyl)-2-methylundec-1-ene |
| SMILES | C=C(C)C(CCCCCCCC)C(C)(OCC)OCC |
| InChI | InChI=1S/C18H36O2/c1-7-10-11-12-13-14-15-17(16(4)5)18(6,19-8-2)20-9-3/h17H,4,7-15H2,1-3,5-6H3 |
| InChIKey | TUNQXLHROWQTRL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-diethoxyethyl)-2-methylundec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-diethoxyethyl)-2-methylundec-1-ene?
The IUPAC name of 3-(1,1-diethoxyethyl)-2-methylundec-1-ene (CID 151940396) is 3-(1,1-diethoxyethyl)-2-methylundec-1-ene.
What is the SMILES notation for 3-(1,1-diethoxyethyl)-2-methylundec-1-ene?
The canonical SMILES for 3-(1,1-diethoxyethyl)-2-methylundec-1-ene is C=C(C)C(CCCCCCCC)C(C)(OCC)OCC.
What is the InChIKey of 3-(1,1-diethoxyethyl)-2-methylundec-1-ene?
The InChIKey is TUNQXLHROWQTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-7-10-11-12-13-14-15-17(16(4)5)18(6,19-8-2)20-9-3/h17H,4,7-15H2,1-3,5-6H3.
What are the key properties of 3-(1,1-diethoxyethyl)-2-methylundec-1-ene?
3-(1,1-diethoxyethyl)-2-methylundec-1-ene has a molecular weight of 284.48 g/mol, XLogP of 5.72, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-diethoxyethyl)-2-methylundec-1-ene is sourced from PubChem (CID 151940396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).