C21H19ClO5 — CID 151941650
1-(5-chloro-2-phenoxyphenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 151941650) has the molecular formula C21H19ClO5 and a molecular weight of 386.83 g/mol. Its IUPAC name is 1-(5-chloro-2-phenoxyphenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 1-(5-chloro-2-phenoxyphenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151941650 |
| Molecular Formula | C21H19ClO5 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-(5-chloro-2-phenoxyphenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CCC(C(=O)O)(c2cc(Cl)ccc2Oc2ccccc2)C1 |
| InChI | InChI=1S/C21H19ClO5/c1-20(18(23)24)10-5-11-21(13-20,19(25)26)16-12-14(22)8-9-17(16)27-15-6-3-2-4-7-15/h2-10,12H,11,13H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | TUUOGLGPLMLXMG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|