About 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone
5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone (PubChem CID 15194252) has the molecular formula C19H13NO3
and a molecular weight of 303.32 g/mol. Its IUPAC name is 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone |
| PubChem CID | 15194252 |
| Molecular Formula | C19H13NO3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone |
| SMILES | O=C(c1cnc2c(c1)COc1ccccc1-2)c1ccccc1O |
| InChI | InChI=1S/C19H13NO3/c21-16-7-3-1-5-14(16)19(22)12-9-13-11-23-17-8-4-2-6-15(17)18(13)20-10-12/h1-10,21H,11H2 |
| InChIKey | RSTIXHIVACFCEQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone?
The IUPAC name of 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone (CID 15194252) is 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone.
What is the SMILES notation for 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone?
The canonical SMILES for 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone is O=C(c1cnc2c(c1)COc1ccccc1-2)c1ccccc1O.
What is the InChIKey of 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone?
The InChIKey is RSTIXHIVACFCEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO3/c21-16-7-3-1-5-14(16)19(22)12-9-13-11-23-17-8-4-2-6-15(17)18(13)20-10-12/h1-10,21H,11H2.
What are the key properties of 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone?
5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone has a molecular weight of 303.32 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-chromeno[4,3-b]pyridin-3-yl-(2-hydroxyphenyl)methanone is sourced from PubChem (CID 15194252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).