C11H16O4 — CID 15194324
(1R,2S,4R,5S)-1,5-bis(hydroxymethyl)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 15194324) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (1R,2S,4R,5S)-1,5-bis(hydroxymethyl)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,4R,5S)-1,5-bis(hydroxymethyl)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 15194324 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1R,2S,4R,5S)-1,5-bis(hydroxymethyl)-2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@]2(CO)C=C[C@@]1(CO)O2 |
| InChI | InChI=1S/C11H16O4/c1-7-9(14)8(2)11(6-13)4-3-10(7,5-12)15-11/h3-4,7-8,12-13H,5-6H2,1-2H3/t7-,8+,10+,11- |
| InChIKey | QCBPJXGTJATFEM-YDRMRZIKSA-N |
| XLogP | -0.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|