About 4H-3,1-benzoxathiin-2-one
4H-3,1-benzoxathiin-2-one (PubChem CID 15194351) has the molecular formula C8H6O2S
and a molecular weight of 166.20 g/mol. Its IUPAC name is 4H-3,1-benzoxathiin-2-one.
Molecular Properties
| Compound Name | 4H-3,1-benzoxathiin-2-one |
| PubChem CID | 15194351 |
| Molecular Formula | C8H6O2S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 4H-3,1-benzoxathiin-2-one |
| SMILES | O=C1OCc2ccccc2S1 |
| InChI | InChI=1S/C8H6O2S/c9-8-10-5-6-3-1-2-4-7(6)11-8/h1-4H,5H2 |
| InChIKey | JLMQWBMFSLPUGF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4H-3,1-benzoxathiin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-3,1-benzoxathiin-2-one?
The IUPAC name of 4H-3,1-benzoxathiin-2-one (CID 15194351) is 4H-3,1-benzoxathiin-2-one.
What is the SMILES notation for 4H-3,1-benzoxathiin-2-one?
The canonical SMILES for 4H-3,1-benzoxathiin-2-one is O=C1OCc2ccccc2S1.
What is the InChIKey of 4H-3,1-benzoxathiin-2-one?
The InChIKey is JLMQWBMFSLPUGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2S/c9-8-10-5-6-3-1-2-4-7(6)11-8/h1-4H,5H2.
What are the key properties of 4H-3,1-benzoxathiin-2-one?
4H-3,1-benzoxathiin-2-one has a molecular weight of 166.20 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-3,1-benzoxathiin-2-one is sourced from PubChem (CID 15194351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).