C22H16F3N5O — CID 151944555
1-[5-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,3-dihydroindol-1-yl]-2-(2,3,5-trifluorophenyl)ethanone (PubChem CID 151944555) has the molecular formula C22H16F3N5O and a molecular weight of 423.40 g/mol. Its IUPAC name is 1-[5-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,3-dihydroindol-1-yl]-2-(2,3,5-trifluorophenyl)ethanone.
| Compound Name | 1-[5-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,3-dihydroindol-1-yl]-2-(2,3,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 151944555 |
| Molecular Formula | C22H16F3N5O |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-[5-(4-amino-7H-pyrrolo[2,3-d]pyrimidin-2-yl)-2,3-dihydroindol-1-yl]-2-(2,3,5-trifluorophenyl)ethanone |
| SMILES | Nc1nc(-c2ccc3c(c2)CCN3C(=O)Cc2cc(F)cc(F)c2F)nc2[nH]ccc12 |
| InChI | InChI=1S/C22H16F3N5O/c23-14-8-13(19(25)16(24)10-14)9-18(31)30-6-4-11-7-12(1-2-17(11)30)21-28-20(26)15-3-5-27-22(15)29-21/h1-3,5,7-8,10H,4,6,9H2,(H3,26,27,28,29) |
| InChIKey | TVJOUGWOSYBSLA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|