C28H25N3O2S — CID 151947056
1,3-diethyl-5-[2-(6-methylpyrido[1,2-f]phenanthridin-8-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 151947056) has the molecular formula C28H25N3O2S and a molecular weight of 467.59 g/mol. Its IUPAC name is 1,3-diethyl-5-[2-(6-methylpyrido[1,2-f]phenanthridin-8-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-diethyl-5-[2-(6-methylpyrido[1,2-f]phenanthridin-8-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 151947056 |
| Molecular Formula | C28H25N3O2S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 1,3-diethyl-5-[2-(6-methylpyrido[1,2-f]phenanthridin-8-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=CC=C2C=C(C)N3C(=C2)c2ccccc2-c2ccccc23)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C28H25N3O2S/c1-4-29-26(32)23(27(33)30(5-2)28(29)34)15-14-19-16-18(3)31-24-13-9-8-11-21(24)20-10-6-7-12-22(20)25(31)17-19/h6-17H,4-5H2,1-3H3 |
| InChIKey | TVWFROAEMGMALI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|