C10H5F7O2 — CID 15194721
2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15194721) has the molecular formula C10H5F7O2 and a molecular weight of 290.13 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15194721 |
| Molecular Formula | C10H5F7O2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C(F)(F)C(F)(F)C(F)(F)F)C(=O)C=CC1=O |
| InChI | InChI=1S/C10H5F7O2/c1-4-5(18)2-3-6(19)7(4)8(11,12)9(13,14)10(15,16)17/h2-3H,1H3 |
| InChIKey | LMMFEBDMYFLPNZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|