About 3-fluoro-1,2-dihydroquinoxaline
3-fluoro-1,2-dihydroquinoxaline (PubChem CID 151947869) has the molecular formula C8H7FN2
and a molecular weight of 150.16 g/mol. Its IUPAC name is 3-fluoro-1,2-dihydroquinoxaline.
Molecular Properties
| Compound Name | 3-fluoro-1,2-dihydroquinoxaline |
| PubChem CID | 151947869 |
| Molecular Formula | C8H7FN2 |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | 3-fluoro-1,2-dihydroquinoxaline |
| SMILES | FC1=Nc2ccccc2NC1 |
| InChI | InChI=1S/C8H7FN2/c9-8-5-10-6-3-1-2-4-7(6)11-8/h1-4,10H,5H2 |
| InChIKey | TWADILOKMSHSOD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1,2-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,2-dihydroquinoxaline?
The IUPAC name of 3-fluoro-1,2-dihydroquinoxaline (CID 151947869) is 3-fluoro-1,2-dihydroquinoxaline.
What is the SMILES notation for 3-fluoro-1,2-dihydroquinoxaline?
The canonical SMILES for 3-fluoro-1,2-dihydroquinoxaline is FC1=Nc2ccccc2NC1.
What is the InChIKey of 3-fluoro-1,2-dihydroquinoxaline?
The InChIKey is TWADILOKMSHSOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2/c9-8-5-10-6-3-1-2-4-7(6)11-8/h1-4,10H,5H2.
What are the key properties of 3-fluoro-1,2-dihydroquinoxaline?
3-fluoro-1,2-dihydroquinoxaline has a molecular weight of 150.16 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,2-dihydroquinoxaline is sourced from PubChem (CID 151947869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).