C19H24O6S — CID 15194813
methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyl-2-propyloxolan-3-yl]acetate (PubChem CID 15194813) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyl-2-propyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyl-2-propyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 15194813 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | methyl 2-[(2R,3R,4S)-4-(benzenesulfonyl)-5-oxo-4-prop-2-enyl-2-propyloxolan-3-yl]acetate |
| SMILES | C=CC[C@@]1(S(=O)(=O)c2ccccc2)C(=O)O[C@H](CCC)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C19H24O6S/c1-4-9-16-15(13-17(20)24-3)19(12-5-2,18(21)25-16)26(22,23)14-10-7-6-8-11-14/h5-8,10-11,15-16H,2,4,9,12-13H2,1,3H3/t15-,16-,19+/m1/s1 |
| InChIKey | YQZULGRLPQZPCE-MDZRGWNJSA-N |
| XLogP | 2.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|